C19H13Cl2N5O3 — CID 169397804
[4-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-methoxyphenyl] 2,4-dichlorobenzoate (PubChem CID 169397804) has the molecular formula C19H13Cl2N5O3 and a molecular weight of 430.25 g/mol. Its IUPAC name is [4-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-methoxyphenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-methoxyphenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 169397804 |
| Molecular Formula | C19H13Cl2N5O3 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | [4-(2,6-diamino-5-cyanopyrimidin-4-yl)-2-methoxyphenyl] 2,4-dichlorobenzoate |
| SMILES | COc1cc(-c2nc(N)nc(N)c2C#N)ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H13Cl2N5O3/c1-28-15-6-9(16-12(8-22)17(23)26-19(24)25-16)2-5-14(15)29-18(27)11-4-3-10(20)7-13(11)21/h2-7H,1H3,(H4,23,24,25,26) |
| InChIKey | ZJOOTAHQYCTRPL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|