C19H19BrN2O4 — CID 168586430
ethyl 4-[4-bromo-2-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)phenoxy]butanoate (PubChem CID 168586430) has the molecular formula C19H19BrN2O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is ethyl 4-[4-bromo-2-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)phenoxy]butanoate.
| Compound Name | ethyl 4-[4-bromo-2-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 168586430 |
| Molecular Formula | C19H19BrN2O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | ethyl 4-[4-bromo-2-(3-cyano-6-methyl-2-oxo-1H-pyridin-4-yl)phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(Br)cc1-c1cc(C)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C19H19BrN2O4/c1-3-25-18(23)5-4-8-26-17-7-6-13(20)10-15(17)14-9-12(2)22-19(24)16(14)11-21/h6-7,9-10H,3-5,8H2,1-2H3,(H,22,24) |
| InChIKey | NMPVBNZFGWKJAG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|