C13H9BrN2O — CID 947694
4-(4-bromophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 947694) has the molecular formula C13H9BrN2O and a molecular weight of 289.13 g/mol. Its IUPAC name is 4-(4-bromophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(4-bromophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 947694 |
| Molecular Formula | C13H9BrN2O |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 4-(4-bromophenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2ccc(Br)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H9BrN2O/c1-8-6-11(12(7-15)13(17)16-8)9-2-4-10(14)5-3-9/h2-6H,1H3,(H,16,17) |
| InChIKey | HOUMLSSTOWODNN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |