C18H10Br2N2O — CID 19656390
4,6-bis(4-bromophenyl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 19656390) has the molecular formula C18H10Br2N2O and a molecular weight of 430.10 g/mol. Its IUPAC name is 4,6-bis(4-bromophenyl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4,6-bis(4-bromophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19656390 |
| Molecular Formula | C18H10Br2N2O |
| Molecular Weight | 430.10 g/mol |
| Exact Mass | 427.92 |
| IUPAC Name | 4,6-bis(4-bromophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Br)cc2)cc(-c2ccc(Br)cc2)[nH]c1=O |
| InChI | InChI=1S/C18H10Br2N2O/c19-13-5-1-11(2-6-13)15-9-17(22-18(23)16(15)10-21)12-3-7-14(20)8-4-12/h1-9H,(H,22,23) |
| InChIKey | MTDHJTKCWYVKGD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.10 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |