C19H13BrN2OS — CID 35212451
6-(4-bromophenyl)-4-(4-methoxyphenyl)-2-sulfanylidene-1H-pyridine-3-carbonitrile (PubChem CID 35212451) has the molecular formula C19H13BrN2OS and a molecular weight of 397.30 g/mol. Its IUPAC name is 6-(4-bromophenyl)-4-(4-methoxyphenyl)-2-sulfanylidene-1H-pyridine-3-carbonitrile.
| Compound Name | 6-(4-bromophenyl)-4-(4-methoxyphenyl)-2-sulfanylidene-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 35212451 |
| Molecular Formula | C19H13BrN2OS |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 6-(4-bromophenyl)-4-(4-methoxyphenyl)-2-sulfanylidene-1H-pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3ccc(Br)cc3)[nH]c(=S)c2C#N)cc1 |
| InChI | InChI=1S/C19H13BrN2OS/c1-23-15-8-4-12(5-9-15)16-10-18(22-19(24)17(16)11-21)13-2-6-14(20)7-3-13/h2-10H,1H3,(H,22,24) |
| InChIKey | LSWJKIWHXJFCMP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|