C14H10N4OS — CID 4161738
2-amino-4-(4-methoxyphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile (PubChem CID 4161738) has the molecular formula C14H10N4OS and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-amino-4-(4-methoxyphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-(4-methoxyphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 4161738 |
| Molecular Formula | C14H10N4OS |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-amino-4-(4-methoxyphenyl)-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile |
| SMILES | COc1ccc(-c2c(C#N)c(N)[nH]c(=S)c2C#N)cc1 |
| InChI | InChI=1S/C14H10N4OS/c1-19-9-4-2-8(3-5-9)12-10(6-15)13(17)18-14(20)11(12)7-16/h2-5H,1H3,(H3,17,18,20) |
| InChIKey | ZYLUJIUASPPJEP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|