C24H21N5O4S2 — CID 140560692
2-amino-4-[4-[(3R,4R)-4-hydroxy-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]oxyphenyl]-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile (PubChem CID 140560692) has the molecular formula C24H21N5O4S2 and a molecular weight of 507.60 g/mol. Its IUPAC name is 2-amino-4-[4-[(3R,4R)-4-hydroxy-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]oxyphenyl]-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-4-[4-[(3R,4R)-4-hydroxy-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]oxyphenyl]-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 140560692 |
| Molecular Formula | C24H21N5O4S2 |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | 2-amino-4-[4-[(3R,4R)-4-hydroxy-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]oxyphenyl]-6-sulfanylidene-1H-pyridine-3,5-dicarbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](O)[C@H](Oc3ccc(-c4c(C#N)c(N)[nH]c(=S)c4C#N)cc3)C2)cc1 |
| InChI | InChI=1S/C24H21N5O4S2/c1-14-2-8-17(9-3-14)35(31,32)29-12-20(30)21(13-29)33-16-6-4-15(5-7-16)22-18(10-25)23(27)28-24(34)19(22)11-26/h2-9,20-21,30H,12-13H2,1H3,(H3,27,28,34)/t20-,21-/m1/s1 |
| InChIKey | YVSAOPJCNJIIBQ-NHCUHLMSSA-N |
| XLogP | 2.86 |
| TPSA | 156.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|