C19H24N2O4S — CID 154866673
(3R,4R)-1-[4-[(dimethylamino)methyl]phenyl]sulfonyl-4-phenoxypyrrolidin-3-ol (PubChem CID 154866673) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is (3R,4R)-1-[4-[(dimethylamino)methyl]phenyl]sulfonyl-4-phenoxypyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-[4-[(dimethylamino)methyl]phenyl]sulfonyl-4-phenoxypyrrolidin-3-ol |
|---|---|
| PubChem CID | 154866673 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (3R,4R)-1-[4-[(dimethylamino)methyl]phenyl]sulfonyl-4-phenoxypyrrolidin-3-ol |
| SMILES | CN(C)Cc1ccc(S(=O)(=O)N2C[C@@H](O)[C@H](Oc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-20(2)12-15-8-10-17(11-9-15)26(23,24)21-13-18(22)19(14-21)25-16-6-4-3-5-7-16/h3-11,18-19,22H,12-14H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | VGEQJHCOJZZBTI-RTBURBONSA-N |
| XLogP | 1.56 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |