C17H17FN2O4S — CID 18767815
benzyl-[1-(4-fluorophenyl)sulfonylazetidin-3-yl]carbamic acid (PubChem CID 18767815) has the molecular formula C17H17FN2O4S and a molecular weight of 364.40 g/mol. Its IUPAC name is benzyl-[1-(4-fluorophenyl)sulfonylazetidin-3-yl]carbamic acid.
| Compound Name | benzyl-[1-(4-fluorophenyl)sulfonylazetidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 18767815 |
| Molecular Formula | C17H17FN2O4S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | benzyl-[1-(4-fluorophenyl)sulfonylazetidin-3-yl]carbamic acid |
| SMILES | O=C(O)N(Cc1ccccc1)C1CN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H17FN2O4S/c18-14-6-8-16(9-7-14)25(23,24)19-11-15(12-19)20(17(21)22)10-13-4-2-1-3-5-13/h1-9,15H,10-12H2,(H,21,22) |
| InChIKey | LUOWTTZAOAUMJI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |