C13H15FN2O4S — CID 126506453
(3aS,6aR)-5-(4-fluorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylic acid (PubChem CID 126506453) has the molecular formula C13H15FN2O4S and a molecular weight of 314.34 g/mol. Its IUPAC name is (3aS,6aR)-5-(4-fluorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylic acid.
| Compound Name | (3aS,6aR)-5-(4-fluorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 126506453 |
| Molecular Formula | C13H15FN2O4S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (3aS,6aR)-5-(4-fluorophenyl)sulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)N1C[C@@H]2CN(S(=O)(=O)c3ccc(F)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C13H15FN2O4S/c14-11-1-3-12(4-2-11)21(19,20)16-7-9-5-15(13(17)18)6-10(9)8-16/h1-4,9-10H,5-8H2,(H,17,18)/t9-,10+ |
| InChIKey | QFBVIRUDFGTEGR-AOOOYVTPSA-N |
| XLogP | 1.06 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |