C19H21ClFN3O3S — CID 120665514
N-[4-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]phenyl]-4-fluorobenzamide;hydrochloride (PubChem CID 120665514) has the molecular formula C19H21ClFN3O3S and a molecular weight of 425.91 g/mol. Its IUPAC name is N-[4-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]phenyl]-4-fluorobenzamide;hydrochloride.
| Compound Name | N-[4-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]phenyl]-4-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 120665514 |
| Molecular Formula | C19H21ClFN3O3S |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[4-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]phenyl]-4-fluorobenzamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(S(=O)(=O)N2C[C@H]3CNC[C@H]3C2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN3O3S.ClH/c20-16-3-1-13(2-4-16)19(24)22-17-5-7-18(8-6-17)27(25,26)23-11-14-9-21-10-15(14)12-23;/h1-8,14-15,21H,9-12H2,(H,22,24);1H/t14-,15+; |
| InChIKey | AMSHEHGTZJEJHC-KBGJBQQCSA-N |
| XLogP | 2.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |