C9H10FNO3S — CID 63106433
1-(4-fluorophenyl)sulfonylazetidin-3-ol (PubChem CID 63106433) has the molecular formula C9H10FNO3S and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonylazetidin-3-ol.
| Compound Name | 1-(4-fluorophenyl)sulfonylazetidin-3-ol |
|---|---|
| PubChem CID | 63106433 |
| Molecular Formula | C9H10FNO3S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonylazetidin-3-ol |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CC(O)C1 |
| InChI | InChI=1S/C9H10FNO3S/c10-7-1-3-9(4-2-7)15(13,14)11-5-8(12)6-11/h1-4,8,12H,5-6H2 |
| InChIKey | ZDQLEIUFLYWISB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |