C13H16BrNO3S — CID 11336921
(3R,4R)-4-(1-bromoethenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol (PubChem CID 11336921) has the molecular formula C13H16BrNO3S and a molecular weight of 346.25 g/mol. Its IUPAC name is (3R,4R)-4-(1-bromoethenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-(1-bromoethenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 11336921 |
| Molecular Formula | C13H16BrNO3S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | (3R,4R)-4-(1-bromoethenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol |
| SMILES | C=C(Br)[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)C[C@@H]1O |
| InChI | InChI=1S/C13H16BrNO3S/c1-9-3-5-11(6-4-9)19(17,18)15-7-12(10(2)14)13(16)8-15/h3-6,12-13,16H,2,7-8H2,1H3/t12-,13-/m0/s1 |
| InChIKey | JOAVVNVLMUZXIL-STQMWFEESA-N |
| XLogP | 1.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |