C14H16N2O4S — CID 92539490
(1R,5S)-7-(4-methylphenyl)sulfonyl-3,7-diazabicyclo[3.3.1]nonane-2,4-dione (PubChem CID 92539490) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is (1R,5S)-7-(4-methylphenyl)sulfonyl-3,7-diazabicyclo[3.3.1]nonane-2,4-dione.
| Compound Name | (1R,5S)-7-(4-methylphenyl)sulfonyl-3,7-diazabicyclo[3.3.1]nonane-2,4-dione |
|---|---|
| PubChem CID | 92539490 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (1R,5S)-7-(4-methylphenyl)sulfonyl-3,7-diazabicyclo[3.3.1]nonane-2,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3C[C@@H](C2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C14H16N2O4S/c1-9-2-4-12(5-3-9)21(19,20)16-7-10-6-11(8-16)14(18)15-13(10)17/h2-5,10-11H,6-8H2,1H3,(H,15,17,18)/t10-,11+ |
| InChIKey | OSPKWPGDONGBRE-PHIMTYICSA-N |
| XLogP | 0.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|