C26H30N2O4S2 — CID 12983128
(1E,8E)-6,13-bis-(4-methylphenyl)sulfonyl-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1,8-diene (PubChem CID 12983128) has the molecular formula C26H30N2O4S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is (1E,8E)-6,13-bis-(4-methylphenyl)sulfonyl-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1,8-diene.
| Compound Name | (1E,8E)-6,13-bis-(4-methylphenyl)sulfonyl-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1,8-diene |
|---|---|
| PubChem CID | 12983128 |
| Molecular Formula | C26H30N2O4S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | (1E,8E)-6,13-bis-(4-methylphenyl)sulfonyl-6,13-diazatricyclo[9.3.0.04,8]tetradeca-1,8-diene |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C3=C/CC4CN(S(=O)(=O)c5ccc(C)cc5)C/C4=C/CC3C2)cc1 |
| InChI | InChI=1S/C26H30N2O4S2/c1-19-3-11-25(12-4-19)33(29,30)27-15-21-7-9-23-17-28(18-24(23)10-8-22(21)16-27)34(31,32)26-13-5-20(2)6-14-26/h3-7,10-14,22-23H,8-9,15-18H2,1-2H3/b21-7-,24-10- |
| InChIKey | YASWCWIOZOOWMD-DENBNGNCSA-N |
| XLogP | 3.89 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|