C14H20FNO4S — CID 123600638
5-(1-fluoroethyl)-1-(4-methylphenyl)sulfonylpiperidine-3,4-diol (PubChem CID 123600638) has the molecular formula C14H20FNO4S and a molecular weight of 317.38 g/mol. Its IUPAC name is 5-(1-fluoroethyl)-1-(4-methylphenyl)sulfonylpiperidine-3,4-diol.
| Compound Name | 5-(1-fluoroethyl)-1-(4-methylphenyl)sulfonylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 123600638 |
| Molecular Formula | C14H20FNO4S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 5-(1-fluoroethyl)-1-(4-methylphenyl)sulfonylpiperidine-3,4-diol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(O)C(O)C(C(C)F)C2)cc1 |
| InChI | InChI=1S/C14H20FNO4S/c1-9-3-5-11(6-4-9)21(19,20)16-7-12(10(2)15)14(18)13(17)8-16/h3-6,10,12-14,17-18H,7-8H2,1-2H3 |
| InChIKey | QPGJSDDYTPEMHE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |