C22H26N2O4S2 — CID 132565865
2,5-bis-(4-methylphenyl)sulfonyl-1,3,3a,4,6,8a-hexahydropyrrolo[3,4-c]azepine (PubChem CID 132565865) has the molecular formula C22H26N2O4S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2,5-bis-(4-methylphenyl)sulfonyl-1,3,3a,4,6,8a-hexahydropyrrolo[3,4-c]azepine.
| Compound Name | 2,5-bis-(4-methylphenyl)sulfonyl-1,3,3a,4,6,8a-hexahydropyrrolo[3,4-c]azepine |
|---|---|
| PubChem CID | 132565865 |
| Molecular Formula | C22H26N2O4S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2,5-bis-(4-methylphenyl)sulfonyl-1,3,3a,4,6,8a-hexahydropyrrolo[3,4-c]azepine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=CC3CN(S(=O)(=O)c4ccc(C)cc4)CC3C2)cc1 |
| InChI | InChI=1S/C22H26N2O4S2/c1-17-5-9-21(10-6-17)29(25,26)23-13-3-4-19-14-24(16-20(19)15-23)30(27,28)22-11-7-18(2)8-12-22/h3-12,19-20H,13-16H2,1-2H3 |
| InChIKey | JFVPIVVQZHUYAW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|