C20H23NO4S — CID 166441489
(R)-(2-methoxyphenyl)-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]methanol (PubChem CID 166441489) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is (R)-(2-methoxyphenyl)-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]methanol.
| Compound Name | (R)-(2-methoxyphenyl)-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 166441489 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (R)-(2-methoxyphenyl)-[(3S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-3-yl]methanol |
| SMILES | COc1ccccc1[C@H](O)[C@H]1C=CCN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C20H23NO4S/c1-15-9-11-17(12-10-15)26(23,24)21-13-5-6-16(14-21)20(22)18-7-3-4-8-19(18)25-2/h3-12,16,20,22H,13-14H2,1-2H3/t16-,20+/m0/s1 |
| InChIKey | BTWSRYPVOPTNJB-OXJNMPFZSA-N |
| XLogP | 2.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|