C16H21NO6S2 — CID 11246192
methyl 2-[(6Z)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,3,5,8-tetrahydro-1,4-thiazocin-2-yl]acetate (PubChem CID 11246192) has the molecular formula C16H21NO6S2 and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl 2-[(6Z)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,3,5,8-tetrahydro-1,4-thiazocin-2-yl]acetate.
| Compound Name | methyl 2-[(6Z)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,3,5,8-tetrahydro-1,4-thiazocin-2-yl]acetate |
|---|---|
| PubChem CID | 11246192 |
| Molecular Formula | C16H21NO6S2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | methyl 2-[(6Z)-4-(4-methylphenyl)sulfonyl-1,1-dioxo-2,3,5,8-tetrahydro-1,4-thiazocin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(S(=O)(=O)c2ccc(C)cc2)C/C=C\CS1(=O)=O |
| InChI | InChI=1S/C16H21NO6S2/c1-13-5-7-14(8-6-13)25(21,22)17-9-3-4-10-24(19,20)15(12-17)11-16(18)23-2/h3-8,15H,9-12H2,1-2H3/b4-3- |
| InChIKey | VNEZYKZTRGCZOL-ARJAWSKDSA-N |
| XLogP | 0.90 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|