C22H28N2O4S2 — CID 102269003
(8Z)-1,6-bis-(4-methylphenyl)sulfonyl-2,3,4,5,7,10-hexahydro-1,6-diazecine (PubChem CID 102269003) has the molecular formula C22H28N2O4S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is (8Z)-1,6-bis-(4-methylphenyl)sulfonyl-2,3,4,5,7,10-hexahydro-1,6-diazecine.
| Compound Name | (8Z)-1,6-bis-(4-methylphenyl)sulfonyl-2,3,4,5,7,10-hexahydro-1,6-diazecine |
|---|---|
| PubChem CID | 102269003 |
| Molecular Formula | C22H28N2O4S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (8Z)-1,6-bis-(4-methylphenyl)sulfonyl-2,3,4,5,7,10-hexahydro-1,6-diazecine |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C=C\CN(S(=O)(=O)c3ccc(C)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C22H28N2O4S2/c1-19-7-11-21(12-8-19)29(25,26)23-15-3-5-17-24(18-6-4-16-23)30(27,28)22-13-9-20(2)10-14-22/h3,5,7-14H,4,6,15-18H2,1-2H3/b5-3- |
| InChIKey | MCAVEGGSZIYEJS-HYXAFXHYSA-N |
| XLogP | 3.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|