C14H17NO3S — CID 102167757
(6Z)-1-(4-methylphenyl)sulfonyl-2,4,5,8-tetrahydroazocin-3-one (PubChem CID 102167757) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is (6Z)-1-(4-methylphenyl)sulfonyl-2,4,5,8-tetrahydroazocin-3-one.
| Compound Name | (6Z)-1-(4-methylphenyl)sulfonyl-2,4,5,8-tetrahydroazocin-3-one |
|---|---|
| PubChem CID | 102167757 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (6Z)-1-(4-methylphenyl)sulfonyl-2,4,5,8-tetrahydroazocin-3-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C=C\CCC(=O)C2)cc1 |
| InChI | InChI=1S/C14H17NO3S/c1-12-6-8-14(9-7-12)19(17,18)15-10-4-2-3-5-13(16)11-15/h2,4,6-9H,3,5,10-11H2,1H3/b4-2- |
| InChIKey | SJOJESUMLBFYFR-RQOWECAXSA-N |
| XLogP | 1.90 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|