C17H16ClNO2S — CID 86224949
3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole (PubChem CID 86224949) has the molecular formula C17H16ClNO2S and a molecular weight of 333.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole.
| Compound Name | 3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 86224949 |
| Molecular Formula | C17H16ClNO2S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=C(c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C17H16ClNO2S/c1-13-2-8-17(9-3-13)22(20,21)19-11-10-15(12-19)14-4-6-16(18)7-5-14/h2-10H,11-12H2,1H3 |
| InChIKey | OYIWVQVVUNGWER-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |