C18H19NO3S — CID 101387033
3-(3-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole (PubChem CID 101387033) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole.
| Compound Name | 3-(3-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 101387033 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-(3-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole |
| SMILES | COc1cccc(C2=CCN(S(=O)(=O)c3ccc(C)cc3)C2)c1 |
| InChI | InChI=1S/C18H19NO3S/c1-14-6-8-18(9-7-14)23(20,21)19-11-10-16(13-19)15-4-3-5-17(12-15)22-2/h3-10,12H,11,13H2,1-2H3 |
| InChIKey | MIDPHCCTJCPCMA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |