C24H25NO3S — CID 102182418
(3R,4S)-3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidine (PubChem CID 102182418) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is (3R,4S)-3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidine.
| Compound Name | (3R,4S)-3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidine |
|---|---|
| PubChem CID | 102182418 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (3R,4S)-3-(4-methoxyphenyl)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidine |
| SMILES | COc1ccc([C@@H]2CN(S(=O)(=O)c3ccc(C)cc3)C[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO3S/c1-18-8-14-22(15-9-18)29(26,27)25-16-23(19-6-4-3-5-7-19)24(17-25)20-10-12-21(28-2)13-11-20/h3-15,23-24H,16-17H2,1-2H3/t23-,24+/m1/s1 |
| InChIKey | MYQLQEGYBPTZEL-RPWUZVMVSA-N |
| XLogP | 4.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |