C33H37NO2SSi — CID 59053091
tert-butyl-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-3-yl]-diphenylsilane (PubChem CID 59053091) has the molecular formula C33H37NO2SSi and a molecular weight of 539.82 g/mol. Its IUPAC name is tert-butyl-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-3-yl]-diphenylsilane.
| Compound Name | tert-butyl-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-3-yl]-diphenylsilane |
|---|---|
| PubChem CID | 59053091 |
| Molecular Formula | C33H37NO2SSi |
| Molecular Weight | 539.82 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | tert-butyl-[(3S,4R)-1-(4-methylphenyl)sulfonyl-4-phenylpyrrolidin-3-yl]-diphenylsilane |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]([Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C33H37NO2SSi/c1-26-20-22-28(23-21-26)37(35,36)34-24-31(27-14-8-5-9-15-27)32(25-34)38(33(2,3)4,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-23,31-32H,24-25H2,1-4H3/t31-,32+/m0/s1 |
| InChIKey | JCKGQZCUARLEGK-AJQTZOPKSA-N |
| XLogP | 6.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.82 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|