C23H24N2O2S — CID 132992660
(4R)-3-(3-methylphenyl)-1-(4-methylphenyl)sulfonyl-4-phenylimidazolidine (PubChem CID 132992660) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is (4R)-3-(3-methylphenyl)-1-(4-methylphenyl)sulfonyl-4-phenylimidazolidine.
| Compound Name | (4R)-3-(3-methylphenyl)-1-(4-methylphenyl)sulfonyl-4-phenylimidazolidine |
|---|---|
| PubChem CID | 132992660 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (4R)-3-(3-methylphenyl)-1-(4-methylphenyl)sulfonyl-4-phenylimidazolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](c3ccccc3)N(c3cccc(C)c3)C2)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-18-11-13-22(14-12-18)28(26,27)24-16-23(20-8-4-3-5-9-20)25(17-24)21-10-6-7-19(2)15-21/h3-15,23H,16-17H2,1-2H3/t23-/m0/s1 |
| InChIKey | GOUKZYYPDLMUHX-QHCPKHFHSA-N |
| XLogP | 4.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |