C30H28N2O2S — CID 162406799
(2Z)-2-benzylidene-1-(4-methylphenyl)sulfonyl-4,5-diphenylpiperazine (PubChem CID 162406799) has the molecular formula C30H28N2O2S and a molecular weight of 480.63 g/mol. Its IUPAC name is (2Z)-2-benzylidene-1-(4-methylphenyl)sulfonyl-4,5-diphenylpiperazine.
| Compound Name | (2Z)-2-benzylidene-1-(4-methylphenyl)sulfonyl-4,5-diphenylpiperazine |
|---|---|
| PubChem CID | 162406799 |
| Molecular Formula | C30H28N2O2S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (2Z)-2-benzylidene-1-(4-methylphenyl)sulfonyl-4,5-diphenylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(c3ccccc3)N(c3ccccc3)C/C2=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N2O2S/c1-24-17-19-29(20-18-24)35(33,34)32-23-30(26-13-7-3-8-14-26)31(27-15-9-4-10-16-27)22-28(32)21-25-11-5-2-6-12-25/h2-21,30H,22-23H2,1H3/b28-21- |
| InChIKey | WFVLWOICYIMARY-HFTWOUSFSA-N |
| XLogP | 6.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |