C24H23IN2O2S — CID 162406807
1-(4-iodophenyl)-5-methyl-4-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrazine (PubChem CID 162406807) has the molecular formula C24H23IN2O2S and a molecular weight of 530.43 g/mol. Its IUPAC name is 1-(4-iodophenyl)-5-methyl-4-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrazine.
| Compound Name | 1-(4-iodophenyl)-5-methyl-4-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrazine |
|---|---|
| PubChem CID | 162406807 |
| Molecular Formula | C24H23IN2O2S |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | 1-(4-iodophenyl)-5-methyl-4-(4-methylphenyl)sulfonyl-2-phenyl-2,3-dihydropyrazine |
| SMILES | CC1=CN(c2ccc(I)cc2)C(c2ccccc2)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H23IN2O2S/c1-18-8-14-23(15-9-18)30(28,29)27-17-24(20-6-4-3-5-7-20)26(16-19(27)2)22-12-10-21(25)11-13-22/h3-16,24H,17H2,1-2H3 |
| InChIKey | ZSJSXPIGLJRDPW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|