C26H26N2O4S — CID 162406802
[4-[5-methyl-4-(4-methylphenyl)sulfonyl-1-phenyl-2,3-dihydropyrazin-2-yl]phenyl] acetate (PubChem CID 162406802) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is [4-[5-methyl-4-(4-methylphenyl)sulfonyl-1-phenyl-2,3-dihydropyrazin-2-yl]phenyl] acetate.
| Compound Name | [4-[5-methyl-4-(4-methylphenyl)sulfonyl-1-phenyl-2,3-dihydropyrazin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 162406802 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [4-[5-methyl-4-(4-methylphenyl)sulfonyl-1-phenyl-2,3-dihydropyrazin-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2CN(S(=O)(=O)c3ccc(C)cc3)C(C)=CN2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N2O4S/c1-19-9-15-25(16-10-19)33(30,31)28-18-26(22-11-13-24(14-12-22)32-21(3)29)27(17-20(28)2)23-7-5-4-6-8-23/h4-17,26H,18H2,1-3H3 |
| InChIKey | NHKXSZZWSZANLB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|