C23H20N2O2 — CID 7065243
[4-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenyl] acetate (PubChem CID 7065243) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is [4-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenyl] acetate.
| Compound Name | [4-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 7065243 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [4-[(3R)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2=NN(c3ccccc3)[C@@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H20N2O2/c1-17(26)27-21-14-12-18(13-15-21)22-16-23(19-8-4-2-5-9-19)25(24-22)20-10-6-3-7-11-20/h2-15,23H,16H2,1H3/t23-/m1/s1 |
| InChIKey | YEASCLFTFSBMLB-HSZRJFAPSA-N |
| XLogP | 4.97 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|