C23H20N2O — CID 3756212
4-[5-(4-methylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]benzaldehyde (PubChem CID 3756212) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-[5-(4-methylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]benzaldehyde.
| Compound Name | 4-[5-(4-methylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 3756212 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-[5-(4-methylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]benzaldehyde |
| SMILES | Cc1ccc(C2=NN(c3ccc(C=O)cc3)C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H20N2O/c1-17-7-11-19(12-8-17)22-15-23(20-5-3-2-4-6-20)25(24-22)21-13-9-18(16-26)10-14-21/h2-14,16,23H,15H2,1H3 |
| InChIKey | UOQNRDFUPLYMMC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|