C30H27N3 — CID 40877279
1-[4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine (PubChem CID 40877279) has the molecular formula C30H27N3 and a molecular weight of 429.57 g/mol. Its IUPAC name is 1-[4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine.
| Compound Name | 1-[4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine |
|---|---|
| PubChem CID | 40877279 |
| Molecular Formula | C30H27N3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 1-[4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-[(1S)-1-phenylethyl]methanimine |
| SMILES | C[C@H](/N=C/c1ccc(N2N=C(c3ccccc3)C[C@@H]2c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H27N3/c1-23(25-11-5-2-6-12-25)31-22-24-17-19-28(20-18-24)33-30(27-15-9-4-10-16-27)21-29(32-33)26-13-7-3-8-14-26/h2-20,22-23,30H,21H2,1H3/b31-22+/t23-,30+/m0/s1 |
| InChIKey | NHIVKJVPLGQPJF-WVYNYODQSA-N |
| XLogP | 7.22 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|