C27H30N5+ — CID 7742090
(Z)-1-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-(4-methylpiperazin-4-ium-1-yl)methanimine (PubChem CID 7742090) has the molecular formula C27H30N5+ and a molecular weight of 424.57 g/mol. Its IUPAC name is (Z)-1-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-(4-methylpiperazin-4-ium-1-yl)methanimine.
| Compound Name | (Z)-1-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-(4-methylpiperazin-4-ium-1-yl)methanimine |
|---|---|
| PubChem CID | 7742090 |
| Molecular Formula | C27H30N5+ |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | (Z)-1-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-N-(4-methylpiperazin-4-ium-1-yl)methanimine |
| SMILES | C[NH+]1CCN(/N=C\c2ccc(N3N=C(c4ccccc4)C[C@H]3c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C27H29N5/c1-30-16-18-31(19-17-30)28-21-22-12-14-25(15-13-22)32-27(24-10-6-3-7-11-24)20-26(29-32)23-8-4-2-5-9-23/h2-15,21,27H,16-20H2,1H3/p+1/b28-21-/t27-/m0/s1 |
| InChIKey | ANGRLOSXOUVOKZ-ISLVRDBWSA-O |
| XLogP | 3.21 |
| TPSA | 35.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|