C29H25N3O — CID 3756039
3-[[4-[5-(4-methylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]phenol (PubChem CID 3756039) has the molecular formula C29H25N3O and a molecular weight of 431.54 g/mol. Its IUPAC name is 3-[[4-[5-(4-methylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]phenol.
| Compound Name | 3-[[4-[5-(4-methylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]phenol |
|---|---|
| PubChem CID | 3756039 |
| Molecular Formula | C29H25N3O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 3-[[4-[5-(4-methylphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]phenol |
| SMILES | Cc1ccc(C2=NN(c3ccc(/C=N/c4cccc(O)c4)cc3)C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C29H25N3O/c1-21-10-14-23(15-11-21)28-19-29(24-6-3-2-4-7-24)32(31-28)26-16-12-22(13-17-26)20-30-25-8-5-9-27(33)18-25/h2-18,20,29,33H,19H2,1H3/b30-20+ |
| InChIKey | CHQJRNIYYPWOAK-TWKHWXDSSA-N |
| XLogP | 6.81 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|