C28H21Cl2N3O — CID 135820671
2,4-dichloro-6-[[3-[(3S)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenyl]iminomethyl]phenol (PubChem CID 135820671) has the molecular formula C28H21Cl2N3O and a molecular weight of 486.40 g/mol. Its IUPAC name is 2,4-dichloro-6-[[3-[(3S)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenyl]iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[[3-[(3S)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135820671 |
| Molecular Formula | C28H21Cl2N3O |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 2,4-dichloro-6-[[3-[(3S)-2,3-diphenyl-3,4-dihydropyrazol-5-yl]phenyl]iminomethyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/c1cccc(C2=NN(c3ccccc3)[C@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C28H21Cl2N3O/c29-22-14-21(28(34)25(30)16-22)18-31-23-11-7-10-20(15-23)26-17-27(19-8-3-1-4-9-19)33(32-26)24-12-5-2-6-13-24/h1-16,18,27,34H,17H2/b31-18+/t27-/m0/s1 |
| InChIKey | BXYXBBQGHBLBFG-NXENVEDLSA-N |
| XLogP | 7.81 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|