C28H22ClN3O — CID 5010578
4-chloro-2-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylideneamino]phenol (PubChem CID 5010578) has the molecular formula C28H22ClN3O and a molecular weight of 451.96 g/mol. Its IUPAC name is 4-chloro-2-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylideneamino]phenol.
| Compound Name | 4-chloro-2-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylideneamino]phenol |
|---|---|
| PubChem CID | 5010578 |
| Molecular Formula | C28H22ClN3O |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 4-chloro-2-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylideneamino]phenol |
| SMILES | Oc1ccc(Cl)cc1/N=C/c1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22ClN3O/c29-23-13-16-28(33)26(17-23)30-19-20-11-14-24(15-12-20)32-27(22-9-5-2-6-10-22)18-25(31-32)21-7-3-1-4-8-21/h1-17,19,27,33H,18H2/b30-19+ |
| InChIKey | LPWPUSOXBDXCQT-NDZAJKAJSA-N |
| XLogP | 7.15 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|