C34H24Cl2N2O2 — CID 3445194
1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]prop-2-en-1-one (PubChem CID 3445194) has the molecular formula C34H24Cl2N2O2 and a molecular weight of 563.48 g/mol. Its IUPAC name is 1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]prop-2-en-1-one.
| Compound Name | 1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3445194 |
| Molecular Formula | C34H24Cl2N2O2 |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1)c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C34H24Cl2N2O2/c35-26-14-17-29(36)28(21-26)33-19-20-34(40-33)32(39)18-13-23-11-15-27(16-12-23)38-31(25-9-5-2-6-10-25)22-30(37-38)24-7-3-1-4-8-24/h1-21,31H,22H2 |
| InChIKey | RPGYNLZUDKOUPZ-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|