C29H21Cl3N4O — CID 6149943
N-[(Z)-[4-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-2-chlorobenzamide (PubChem CID 6149943) has the molecular formula C29H21Cl3N4O and a molecular weight of 547.87 g/mol. Its IUPAC name is N-[(Z)-[4-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-2-chlorobenzamide.
| Compound Name | N-[(Z)-[4-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-2-chlorobenzamide |
|---|---|
| PubChem CID | 6149943 |
| Molecular Formula | C29H21Cl3N4O |
| Molecular Weight | 547.87 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | N-[(Z)-[4-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-2-chlorobenzamide |
| SMILES | O=C(N/N=C\c1ccc(N2N=C(c3ccc(Cl)cc3)CC2c2ccc(Cl)cc2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C29H21Cl3N4O/c30-22-11-7-20(8-12-22)27-17-28(21-9-13-23(31)14-10-21)36(35-27)24-15-5-19(6-16-24)18-33-34-29(37)25-3-1-2-4-26(25)32/h1-16,18,28H,17H2,(H,34,37)/b33-18- |
| InChIKey | PCFMWSKDBSRXFV-OHUYPAJKSA-N |
| XLogP | 7.77 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.87 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|