C29H25N5O2 — CID 5335944
N-[(E)-[4-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-3-carboxamide (PubChem CID 5335944) has the molecular formula C29H25N5O2 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[(E)-[4-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-[4-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 5335944 |
| Molecular Formula | C29H25N5O2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | N-[(E)-[4-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-3-carboxamide |
| SMILES | COc1ccc(C2CC(c3ccccc3)=NN2c2ccc(/C=N/NC(=O)c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C29H25N5O2/c1-36-26-15-11-23(12-16-26)28-18-27(22-6-3-2-4-7-22)33-34(28)25-13-9-21(10-14-25)19-31-32-29(35)24-8-5-17-30-20-24/h2-17,19-20,28H,18H2,1H3,(H,32,35)/b31-19+ |
| InChIKey | MDMKDMDMGVTKQP-ZCTHSVRISA-N |
| XLogP | 5.21 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|