C24H24N4O2 — CID 3375455
[4-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylidenehydrazine (PubChem CID 3375455) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is [4-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylidenehydrazine.
| Compound Name | [4-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylidenehydrazine |
|---|---|
| PubChem CID | 3375455 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [4-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylidenehydrazine |
| SMILES | COc1ccc(C2=NN(c3ccc(C=NN)cc3)C(c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C24H24N4O2/c1-29-21-11-5-18(6-12-21)23-15-24(19-7-13-22(30-2)14-8-19)28(27-23)20-9-3-17(4-10-20)16-26-25/h3-14,16,24H,15,25H2,1-2H3 |
| InChIKey | YNIFCSXDTVAESX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|