C30H27N5O3 — CID 3774407
N-[[4-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 3774407) has the molecular formula C30H27N5O3 and a molecular weight of 505.58 g/mol. Its IUPAC name is N-[[4-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[[4-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 3774407 |
| Molecular Formula | C30H27N5O3 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-[[4-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1ccc(C2=NN(c3ccc(C=NNC(=O)c4ccncc4)cc3)C(c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C30H27N5O3/c1-37-26-11-5-22(6-12-26)28-19-29(23-7-13-27(38-2)14-8-23)35(34-28)25-9-3-21(4-10-25)20-32-33-30(36)24-15-17-31-18-16-24/h3-18,20,29H,19H2,1-2H3,(H,33,36) |
| InChIKey | RLZIYVJOBXGXJW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|