C29H24ClN5O — CID 27273244
N-[(Z)-[4-[(3S)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 27273244) has the molecular formula C29H24ClN5O and a molecular weight of 494.00 g/mol. Its IUPAC name is N-[(Z)-[4-[(3S)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[4-[(3S)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 27273244 |
| Molecular Formula | C29H24ClN5O |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-[(Z)-[4-[(3S)-3-(4-chlorophenyl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | Cc1ccc(C2=NN(c3ccc(/C=N\NC(=O)c4ccncc4)cc3)[C@H](c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C29H24ClN5O/c1-20-2-6-22(7-3-20)27-18-28(23-8-10-25(30)11-9-23)35(34-27)26-12-4-21(5-13-26)19-32-33-29(36)24-14-16-31-17-15-24/h2-17,19,28H,18H2,1H3,(H,33,36)/b32-19-/t28-/m0/s1 |
| InChIKey | XNLWPDXSNDIEQD-OTQJEQPISA-N |
| XLogP | 6.16 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|