C30H25N5O — CID 26790667
N-[(Z)-[4-[(3S)-3-phenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide (PubChem CID 26790667) has the molecular formula C30H25N5O and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[(Z)-[4-[(3S)-3-phenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[4-[(3S)-3-phenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 26790667 |
| Molecular Formula | C30H25N5O |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | N-[(Z)-[4-[(3S)-3-phenyl-5-[(E)-2-phenylethenyl]-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(N2N=C(/C=C/c3ccccc3)C[C@H]2c2ccccc2)cc1)c1ccncc1 |
| InChI | InChI=1S/C30H25N5O/c36-30(26-17-19-31-20-18-26)33-32-22-24-12-15-28(16-13-24)35-29(25-9-5-2-6-10-25)21-27(34-35)14-11-23-7-3-1-4-8-23/h1-20,22,29H,21H2,(H,33,36)/b14-11+,32-22-/t29-/m0/s1 |
| InChIKey | WLZZNVJPWDXDQS-QJORVSLZSA-N |
| XLogP | 5.87 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|