C29H23N5O3 — CID 41033095
N-[(Z)-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-4-nitrobenzamide (PubChem CID 41033095) has the molecular formula C29H23N5O3 and a molecular weight of 489.54 g/mol. Its IUPAC name is N-[(Z)-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(Z)-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 41033095 |
| Molecular Formula | C29H23N5O3 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-[(Z)-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-4-nitrobenzamide |
| SMILES | O=C(N/N=C\c1ccc(N2N=C(c3ccccc3)C[C@H]2c2ccccc2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H23N5O3/c35-29(24-13-17-26(18-14-24)34(36)37)31-30-20-21-11-15-25(16-12-21)33-28(23-9-5-2-6-10-23)19-27(32-33)22-7-3-1-4-8-22/h1-18,20,28H,19H2,(H,31,35)/b30-20-/t28-/m0/s1 |
| InChIKey | DAWCIQVYDHOBOA-ASYBXRLASA-N |
| XLogP | 5.71 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|