C28H22N6O4 — CID 40905537
N-[(Z)-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-2,4-dinitroaniline (PubChem CID 40905537) has the molecular formula C28H22N6O4 and a molecular weight of 506.52 g/mol. Its IUPAC name is N-[(Z)-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 40905537 |
| Molecular Formula | C28H22N6O4 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | N-[(Z)-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\c2ccc(N3N=C(c4ccccc4)C[C@H]3c3ccccc3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H22N6O4/c35-33(36)24-15-16-25(28(17-24)34(37)38)30-29-19-20-11-13-23(14-12-20)32-27(22-9-5-2-6-10-22)18-26(31-32)21-7-3-1-4-8-21/h1-17,19,27,30H,18H2/b29-19-/t27-/m0/s1 |
| InChIKey | ILDDGKYCYKBCJY-QTMOJHABSA-N |
| XLogP | 6.30 |
| TPSA | 126.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|