C35H25N3O2 — CID 92853095
(3R)-2-[4-[(E)-(2-nitrofluoren-9-ylidene)methyl]phenyl]-3,5-diphenyl-3,4-dihydropyrazole (PubChem CID 92853095) has the molecular formula C35H25N3O2 and a molecular weight of 519.60 g/mol. Its IUPAC name is (3R)-2-[4-[(E)-(2-nitrofluoren-9-ylidene)methyl]phenyl]-3,5-diphenyl-3,4-dihydropyrazole.
| Compound Name | (3R)-2-[4-[(E)-(2-nitrofluoren-9-ylidene)methyl]phenyl]-3,5-diphenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 92853095 |
| Molecular Formula | C35H25N3O2 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | (3R)-2-[4-[(E)-(2-nitrofluoren-9-ylidene)methyl]phenyl]-3,5-diphenyl-3,4-dihydropyrazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)/C(=C/c1ccc(N3N=C(c4ccccc4)C[C@@H]3c3ccccc3)cc1)c1ccccc1-2 |
| InChI | InChI=1S/C35H25N3O2/c39-38(40)28-19-20-31-29-13-7-8-14-30(29)32(33(31)22-28)21-24-15-17-27(18-16-24)37-35(26-11-5-2-6-12-26)23-34(36-37)25-9-3-1-4-10-25/h1-22,35H,23H2/b32-21+/t35-/m1/s1 |
| InChIKey | WPJWXJJYLBLRMO-PRPIGUFTSA-N |
| XLogP | 8.52 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|