C16H12N4O2 — CID 3129449
2-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazole-3-carbonitrile (PubChem CID 3129449) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazole-3-carbonitrile.
| Compound Name | 2-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 3129449 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazole-3-carbonitrile |
| SMILES | N#CC1CC(c2ccccc2)=NN1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12N4O2/c17-11-15-10-16(12-4-2-1-3-5-12)18-19(15)13-6-8-14(9-7-13)20(21)22/h1-9,15H,10H2 |
| InChIKey | SORVBLCYHAALRU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 82.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|