C21H21N5O2 — CID 51851957
1-ethyl-3-methyl-4-[(3R)-2-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazol-3-yl]pyrazole (PubChem CID 51851957) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-ethyl-3-methyl-4-[(3R)-2-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazol-3-yl]pyrazole.
| Compound Name | 1-ethyl-3-methyl-4-[(3R)-2-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazol-3-yl]pyrazole |
|---|---|
| PubChem CID | 51851957 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-ethyl-3-methyl-4-[(3R)-2-(4-nitrophenyl)-5-phenyl-3,4-dihydropyrazol-3-yl]pyrazole |
| SMILES | CCn1cc([C@H]2CC(c3ccccc3)=NN2c2ccc([N+](=O)[O-])cc2)c(C)n1 |
| InChI | InChI=1S/C21H21N5O2/c1-3-24-14-19(15(2)22-24)21-13-20(16-7-5-4-6-8-16)23-25(21)17-9-11-18(12-10-17)26(27)28/h4-12,14,21H,3,13H2,1-2H3/t21-/m1/s1 |
| InChIKey | BEVFUYHRBMPDFI-OAQYLSRUSA-N |
| XLogP | 4.48 |
| TPSA | 76.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|