C20H18FN5O2 — CID 51424031
4-[(3R)-5-(4-fluorophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazol-3-yl]-1,5-dimethylpyrazole (PubChem CID 51424031) has the molecular formula C20H18FN5O2 and a molecular weight of 379.40 g/mol. Its IUPAC name is 4-[(3R)-5-(4-fluorophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazol-3-yl]-1,5-dimethylpyrazole.
| Compound Name | 4-[(3R)-5-(4-fluorophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazol-3-yl]-1,5-dimethylpyrazole |
|---|---|
| PubChem CID | 51424031 |
| Molecular Formula | C20H18FN5O2 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-[(3R)-5-(4-fluorophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazol-3-yl]-1,5-dimethylpyrazole |
| SMILES | Cc1c([C@H]2CC(c3ccc(F)cc3)=NN2c2ccc([N+](=O)[O-])cc2)cnn1C |
| InChI | InChI=1S/C20H18FN5O2/c1-13-18(12-22-24(13)2)20-11-19(14-3-5-15(21)6-4-14)23-25(20)16-7-9-17(10-8-16)26(27)28/h3-10,12,20H,11H2,1-2H3/t20-/m1/s1 |
| InChIKey | SPUPBMLWHBEWRD-HXUWFJFHSA-N |
| XLogP | 4.13 |
| TPSA | 76.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|