C19H16IN5O2 — CID 51618536
4-[(3R)-5-(4-iodophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazol-3-yl]-1-methylpyrazole (PubChem CID 51618536) has the molecular formula C19H16IN5O2 and a molecular weight of 473.27 g/mol. Its IUPAC name is 4-[(3R)-5-(4-iodophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazol-3-yl]-1-methylpyrazole.
| Compound Name | 4-[(3R)-5-(4-iodophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazol-3-yl]-1-methylpyrazole |
|---|---|
| PubChem CID | 51618536 |
| Molecular Formula | C19H16IN5O2 |
| Molecular Weight | 473.27 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | 4-[(3R)-5-(4-iodophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazol-3-yl]-1-methylpyrazole |
| SMILES | Cn1cc([C@H]2CC(c3ccc(I)cc3)=NN2c2ccc([N+](=O)[O-])cc2)cn1 |
| InChI | InChI=1S/C19H16IN5O2/c1-23-12-14(11-21-23)19-10-18(13-2-4-15(20)5-3-13)22-24(19)16-6-8-17(9-7-16)25(26)27/h2-9,11-12,19H,10H2,1H3/t19-/m1/s1 |
| InChIKey | HIPFFQTZGPVJMG-LJQANCHMSA-N |
| XLogP | 4.29 |
| TPSA | 76.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|